C14H14F4O2 — CID 87840641
3,3,3-trifluoro-2-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-2-hydroxypropanal (PubChem CID 87840641) has the molecular formula C14H14F4O2 and a molecular weight of 290.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-2-hydroxypropanal.
| Compound Name | 3,3,3-trifluoro-2-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-2-hydroxypropanal |
|---|---|
| PubChem CID | 87840641 |
| Molecular Formula | C14H14F4O2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3,3,3-trifluoro-2-[(6-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-2-hydroxypropanal |
| SMILES | O=CC(O)(CC1CCCc2cc(F)ccc21)C(F)(F)F |
| InChI | InChI=1S/C14H14F4O2/c15-11-4-5-12-9(6-11)2-1-3-10(12)7-13(20,8-19)14(16,17)18/h4-6,8,10,20H,1-3,7H2 |
| InChIKey | JKWMYVGTVHASRY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|