C23H29ClN6O7S — CID 87840646
2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione (PubChem CID 87840646) has the molecular formula C23H29ClN6O7S and a molecular weight of 569.04 g/mol. Its IUPAC name is 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione.
| Compound Name | 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 87840646 |
| Molecular Formula | C23H29ClN6O7S |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2-(4-methylsulfonyl-2-nitrobenzoyl)cyclohexane-1,3-dione |
| SMILES | CCNc1nc(Cl)nc(NC(C)(C)C)n1.CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13NO7S.C9H16ClN5/c1-23(21,22)8-5-6-9(10(7-8)15(19)20)14(18)13-11(16)3-2-4-12(13)17;1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5-7,13H,2-4H2,1H3;5H2,1-4H3,(H2,11,12,13,14,15) |
| InChIKey | SKHUEUMSIBXUMX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 191.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|