About 6-diazocyclohexa-2,4-dien-1-amine
6-diazocyclohexa-2,4-dien-1-amine (PubChem CID 87840810) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 6-diazocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-diazocyclohexa-2,4-dien-1-amine |
| PubChem CID | 87840810 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 6-diazocyclohexa-2,4-dien-1-amine |
| SMILES | [N-]=[N+]=C1C=CC=CC1N |
| InChI | InChI=1S/C6H7N3/c7-5-3-1-2-4-6(5)9-8/h1-5H,7H2 |
| InChIKey | AFIIAHJBBDVPHW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazocyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-diazocyclohexa-2,4-dien-1-amine (CID 87840810) is 6-diazocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-diazocyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-diazocyclohexa-2,4-dien-1-amine is [N-]=[N+]=C1C=CC=CC1N.
What is the InChIKey of 6-diazocyclohexa-2,4-dien-1-amine?
The InChIKey is AFIIAHJBBDVPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c7-5-3-1-2-4-6(5)9-8/h1-5H,7H2.
What are the key properties of 6-diazocyclohexa-2,4-dien-1-amine?
6-diazocyclohexa-2,4-dien-1-amine has a molecular weight of 121.14 g/mol, XLogP of 0.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 87840810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).