C9H20F5O4PSi2 — CID 87840955
1,1,3,3,3-pentafluoropropyl bis(trimethylsilyl) phosphate (PubChem CID 87840955) has the molecular formula C9H20F5O4PSi2 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoropropyl bis(trimethylsilyl) phosphate.
| Compound Name | 1,1,3,3,3-pentafluoropropyl bis(trimethylsilyl) phosphate |
|---|---|
| PubChem CID | 87840955 |
| Molecular Formula | C9H20F5O4PSi2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1,1,3,3,3-pentafluoropropyl bis(trimethylsilyl) phosphate |
| SMILES | C[Si](C)(C)OP(=O)(OC(F)(F)CC(F)(F)F)O[Si](C)(C)C |
| InChI | InChI=1S/C9H20F5O4PSi2/c1-20(2,3)17-19(15,18-21(4,5)6)16-9(13,14)7-8(10,11)12/h7H2,1-6H3 |
| InChIKey | DORKICVYSJBZLR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|