C27H28ClN5O3 — CID 87841234
tert-butyl N-[(2S)-2-amino-3-phenylpropanoyl]-N-[6-chloro-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]carbamate (PubChem CID 87841234) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-amino-3-phenylpropanoyl]-N-[6-chloro-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-amino-3-phenylpropanoyl]-N-[6-chloro-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 87841234 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | tert-butyl N-[(2S)-2-amino-3-phenylpropanoyl]-N-[6-chloro-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]carbamate |
| SMILES | Cc1[nH]nc2ccc(-c3cc(N(C(=O)OC(C)(C)C)C(=O)[C@@H](N)Cc4ccccc4)cnc3Cl)cc12 |
| InChI | InChI=1S/C27H28ClN5O3/c1-16-20-13-18(10-11-23(20)32-31-16)21-14-19(15-30-24(21)28)33(26(35)36-27(2,3)4)25(34)22(29)12-17-8-6-5-7-9-17/h5-11,13-15,22H,12,29H2,1-4H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | ZERZTKCASPDQTF-QFIPXVFZSA-N |
| XLogP | 5.42 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|