About 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane
3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane (PubChem CID 87841309) has the molecular formula C24H50O8Si2
and a molecular weight of 522.83 g/mol. Its IUPAC name is 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane.
Molecular Properties
| Compound Name | 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane |
| PubChem CID | 87841309 |
| Molecular Formula | C24H50O8Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane |
| SMILES | C=C(C)C(=O)OCCC[Si](OCC)(OCC)OCC.C=CCCCCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H26O5Si.C11H24O3Si/c1-6-16-19(17-7-2,18-8-3)11-9-10-15-13(14)12(4)5;1-5-6-7-8-9-10-11-15(12-2,13-3)14-4/h4,6-11H2,1-3,5H3;5H,1,6-11H2,2-4H3 |
| InChIKey | IZYKWOHEXKGUIZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane?
The IUPAC name of 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane (CID 87841309) is 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane.
What is the SMILES notation for 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane?
The canonical SMILES for 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane is C=C(C)C(=O)OCCC[Si](OCC)(OCC)OCC.C=CCCCCCC[Si](OC)(OC)OC.
What is the InChIKey of 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane?
The InChIKey is IZYKWOHEXKGUIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5Si.C11H24O3Si/c1-6-16-19(17-7-2,18-8-3)11-9-10-15-13(14)12(4)5;1-5-6-7-8-9-10-11-15(12-2,13-3)14-4/h4,6-11H2,1-3,5H3;5H,1,6-11H2,2-4H3.
What are the key properties of 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane?
3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane has a molecular weight of 522.83 g/mol, XLogP of 5.55, 21 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-triethoxysilylpropyl 2-methylprop-2-enoate;trimethoxy(oct-7-enyl)silane is sourced from PubChem (CID 87841309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).