About 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine
5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine (PubChem CID 87841312) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine |
| PubChem CID | 87841312 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine |
| SMILES | CON(CC(C)C)c1ccc(N)nc1 |
| InChI | InChI=1S/C10H17N3O/c1-8(2)7-13(14-3)9-4-5-10(11)12-6-9/h4-6,8H,7H2,1-3H3,(H2,11,12) |
| InChIKey | MAZAHXMXABXPKI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine?
The IUPAC name of 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine (CID 87841312) is 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine.
What is the SMILES notation for 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine?
The canonical SMILES for 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine is CON(CC(C)C)c1ccc(N)nc1.
What is the InChIKey of 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine?
The InChIKey is MAZAHXMXABXPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-8(2)7-13(14-3)9-4-5-10(11)12-6-9/h4-6,8H,7H2,1-3H3,(H2,11,12).
What are the key properties of 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine?
5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine has a molecular weight of 195.27 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-methoxy-5-N-(2-methylpropyl)pyridine-2,5-diamine is sourced from PubChem (CID 87841312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).