About (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane
(4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane (PubChem CID 87841751) has the molecular formula C13H29F2O5PSi
and a molecular weight of 362.43 g/mol. Its IUPAC name is (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane.
Molecular Properties
| Compound Name | (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane |
| PubChem CID | 87841751 |
| Molecular Formula | C13H29F2O5PSi |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CCCC(F)(F)P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C13H29F2O5PSi/c1-6-17-21(16,18-7-2)13(14,15)11-10-12-22(5,19-8-3)20-9-4/h6-12H2,1-5H3 |
| InChIKey | HZAGURMTTBBGMR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane?
The IUPAC name of (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane (CID 87841751) is (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane.
What is the SMILES notation for (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane?
The canonical SMILES for (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane is CCO[Si](C)(CCCC(F)(F)P(=O)(OCC)OCC)OCC.
What is the InChIKey of (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane?
The InChIKey is HZAGURMTTBBGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29F2O5PSi/c1-6-17-21(16,18-7-2)13(14,15)11-10-12-22(5,19-8-3)20-9-4/h6-12H2,1-5H3.
What are the key properties of (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane?
(4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane has a molecular weight of 362.43 g/mol, XLogP of 4.77, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-diethoxyphosphoryl-4,4-difluorobutyl)-diethoxy-methylsilane is sourced from PubChem (CID 87841751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).