C26H30F2N5O2S+ — CID 87841950
[4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone (PubChem CID 87841950) has the molecular formula C26H30F2N5O2S+ and a molecular weight of 514.62 g/mol. Its IUPAC name is [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 87841950 |
| Molecular Formula | C26H30F2N5O2S+ |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3,5-difluorophenyl)methanone |
| SMILES | Nc1nc(Nc2ccc([N+]3(C4CCNCC4)CCCC(O)C3)cc2)sc1C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C26H29F2N5O2S/c27-17-12-16(13-18(28)14-17)23(35)24-25(29)32-26(36-24)31-19-3-5-20(6-4-19)33(11-1-2-22(34)15-33)21-7-9-30-10-8-21/h3-6,12-14,21-22,30,34H,1-2,7-11,15H2,(H2-,29,31,32,35)/p+1 |
| InChIKey | BOMQOKDKMAVJSW-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|