C27H29F17O9 — CID 87841962
[(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)but-1-enoxy]-2-methyloxan-3-yl] acetate (PubChem CID 87841962) has the molecular formula C27H29F17O9 and a molecular weight of 820.49 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)but-1-enoxy]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)but-1-enoxy]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 87841962 |
| Molecular Formula | C27H29F17O9 |
| Molecular Weight | 820.49 g/mol |
| Exact Mass | 820.15 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-4,5-diacetyloxy-6-[4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)but-1-enoxy]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](C)O[C@@H](OC=CCCOCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H29F17O9/c1-12-16(51-13(2)45)17(52-14(3)46)18(53-15(4)47)19(50-12)49-11-6-5-9-48-10-7-8-20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)26(40,41)27(42,43)44/h6,11-12,16-19H,5,7-10H2,1-4H3/t12-,16-,17+,18+,19+/m0/s1 |
| InChIKey | GPUMDGVBNCJPHJ-SCEVVIGNSA-N |
| XLogP | 7.25 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.49 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|