C8H5Cl7Si — CID 87841973
trichloro-[(2,3,4,5-tetrachloro-6-methylphenyl)methyl]silane (PubChem CID 87841973) has the molecular formula C8H5Cl7Si and a molecular weight of 377.39 g/mol. Its IUPAC name is trichloro-[(2,3,4,5-tetrachloro-6-methylphenyl)methyl]silane.
| Compound Name | trichloro-[(2,3,4,5-tetrachloro-6-methylphenyl)methyl]silane |
|---|---|
| PubChem CID | 87841973 |
| Molecular Formula | C8H5Cl7Si |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 373.80 |
| IUPAC Name | trichloro-[(2,3,4,5-tetrachloro-6-methylphenyl)methyl]silane |
| SMILES | Cc1c(Cl)c(Cl)c(Cl)c(Cl)c1C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H5Cl7Si/c1-3-4(2-16(13,14)15)6(10)8(12)7(11)5(3)9/h2H2,1H3 |
| InChIKey | NCTNXKCGSGCKNK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|