C27H33FN5O3S+ — CID 87842035
[4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 87842035) has the molecular formula C27H33FN5O3S+ and a molecular weight of 526.66 g/mol. Its IUPAC name is [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 87842035 |
| Molecular Formula | C27H33FN5O3S+ |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [4-amino-2-[4-(3-hydroxy-1-piperidin-4-ylpiperidin-1-ium-1-yl)anilino]-1,3-thiazol-5-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2sc(Nc3ccc([N+]4(C5CCNCC5)CCCC(O)C4)cc3)nc2N)cc1F |
| InChI | InChI=1S/C27H32FN5O3S/c1-36-23-9-4-17(15-22(23)28)24(35)25-26(29)32-27(37-25)31-18-5-7-19(8-6-18)33(14-2-3-21(34)16-33)20-10-12-30-13-11-20/h4-9,15,20-21,30,34H,2-3,10-14,16H2,1H3,(H2-,29,31,32,35)/p+1 |
| InChIKey | AVZVTQJEIQPHLV-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|