C38H36N4 — CID 87842183
13,13-dimethyl-20-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-22,24-dihydro-2H-porphyrin (PubChem CID 87842183) has the molecular formula C38H36N4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 13,13-dimethyl-20-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-22,24-dihydro-2H-porphyrin.
| Compound Name | 13,13-dimethyl-20-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-22,24-dihydro-2H-porphyrin |
|---|---|
| PubChem CID | 87842183 |
| Molecular Formula | C38H36N4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 13,13-dimethyl-20-(4-methylphenyl)-5-(2,4,6-trimethylphenyl)-22,24-dihydro-2H-porphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc(cc5nc(cc6ccc2[nH]6)C(C)(C)C=5)[nH]4)=CC3)cc1 |
| InChI | InChI=1S/C38H36N4/c1-22-7-9-26(10-8-22)36-30-13-12-28(40-30)20-34-38(5,6)21-29(41-34)19-27-11-14-32(39-27)37(33-16-15-31(36)42-33)35-24(3)17-23(2)18-25(35)4/h7-14,16-21,39-40H,15H2,1-6H3/b27-19-,28-20-,36-30-,37-32+ |
| InChIKey | SGQZEHCAPOBMPA-USVVQNHDSA-N |
| XLogP | 7.66 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |