C39H41O5P — CID 87842199
2-(1-hydroxycyclohexyl)benzaldehyde;[3-phosphoroso-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 87842199) has the molecular formula C39H41O5P and a molecular weight of 620.73 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)benzaldehyde;[3-phosphoroso-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | 2-(1-hydroxycyclohexyl)benzaldehyde;[3-phosphoroso-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 87842199 |
| Molecular Formula | C39H41O5P |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)benzaldehyde;[3-phosphoroso-2-(2,4,6-trimethylbenzoyl)phenyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2cccc(P=O)c2C(=O)c2c(C)cc(C)cc2C)c(C)c1.O=Cc1ccccc1C1(O)CCCCC1 |
| InChI | InChI=1S/C26H25O3P.C13H16O2/c1-14-10-16(3)22(17(4)11-14)25(27)20-8-7-9-21(30-29)24(20)26(28)23-18(5)12-15(2)13-19(23)6;14-10-11-6-2-3-7-12(11)13(15)8-4-1-5-9-13/h7-13H,1-6H3;2-3,6-7,10,15H,1,4-5,8-9H2 |
| InChIKey | XWIUZFCLTFLASN-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|