C14H10Cl4O3 — CID 87842641
(5,5-dichlorocyclohexa-1,3-diene-1-carbonyl) 5,5-dichlorocyclohexa-1,3-diene-1-carboxylate (PubChem CID 87842641) has the molecular formula C14H10Cl4O3 and a molecular weight of 368.04 g/mol. Its IUPAC name is (5,5-dichlorocyclohexa-1,3-diene-1-carbonyl) 5,5-dichlorocyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (5,5-dichlorocyclohexa-1,3-diene-1-carbonyl) 5,5-dichlorocyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 87842641 |
| Molecular Formula | C14H10Cl4O3 |
| Molecular Weight | 368.04 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | (5,5-dichlorocyclohexa-1,3-diene-1-carbonyl) 5,5-dichlorocyclohexa-1,3-diene-1-carboxylate |
| SMILES | O=C(OC(=O)C1=CC=CC(Cl)(Cl)C1)C1=CC=CC(Cl)(Cl)C1 |
| InChI | InChI=1S/C14H10Cl4O3/c15-13(16)5-1-3-9(7-13)11(19)21-12(20)10-4-2-6-14(17,18)8-10/h1-6H,7-8H2 |
| InChIKey | UHPVEUMHNFKMMF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|