C25H28Cl2F5NO — CID 87843074
1-chloro-2,3,4,5,6-pentafluorobenzene;(1R,9R,13R)-1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride (PubChem CID 87843074) has the molecular formula C25H28Cl2F5NO and a molecular weight of 524.40 g/mol. Its IUPAC name is 1-chloro-2,3,4,5,6-pentafluorobenzene;(1R,9R,13R)-1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride.
| Compound Name | 1-chloro-2,3,4,5,6-pentafluorobenzene;(1R,9R,13R)-1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride |
|---|---|
| PubChem CID | 87843074 |
| Molecular Formula | C25H28Cl2F5NO |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 1-chloro-2,3,4,5,6-pentafluorobenzene;(1R,9R,13R)-1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;hydrochloride |
| SMILES | CC(C)=CCN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2C.Cl.Fc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C19H27NO.C6ClF5.ClH/c1-13(2)7-9-20-10-8-19(4)14(3)18(20)11-15-5-6-16(21)12-17(15)19;7-1-2(8)4(10)6(12)5(11)3(1)9;/h5-7,12,14,18,21H,8-11H2,1-4H3;;1H/t14-,18+,19+;;/m0../s1 |
| InChIKey | RFJCYXHBOSPZAX-NBDGYTBUSA-N |
| XLogP | 7.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|