About 2-benzyl-N-methoxy-N,4-diphenylbenzamide
2-benzyl-N-methoxy-N,4-diphenylbenzamide (PubChem CID 87843433) has the molecular formula C27H23NO2
and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-benzyl-N-methoxy-N,4-diphenylbenzamide.
Molecular Properties
| Compound Name | 2-benzyl-N-methoxy-N,4-diphenylbenzamide |
| PubChem CID | 87843433 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-benzyl-N-methoxy-N,4-diphenylbenzamide |
| SMILES | CON(C(=O)c1ccc(-c2ccccc2)cc1Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23NO2/c1-30-28(25-15-9-4-10-16-25)27(29)26-18-17-23(22-13-7-3-8-14-22)20-24(26)19-21-11-5-2-6-12-21/h2-18,20H,19H2,1H3 |
| InChIKey | HCBFKDQZPLCWJY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-N-methoxy-N,4-diphenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N-methoxy-N,4-diphenylbenzamide?
The IUPAC name of 2-benzyl-N-methoxy-N,4-diphenylbenzamide (CID 87843433) is 2-benzyl-N-methoxy-N,4-diphenylbenzamide.
What is the SMILES notation for 2-benzyl-N-methoxy-N,4-diphenylbenzamide?
The canonical SMILES for 2-benzyl-N-methoxy-N,4-diphenylbenzamide is CON(C(=O)c1ccc(-c2ccccc2)cc1Cc1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzyl-N-methoxy-N,4-diphenylbenzamide?
The InChIKey is HCBFKDQZPLCWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23NO2/c1-30-28(25-15-9-4-10-16-25)27(29)26-18-17-23(22-13-7-3-8-14-22)20-24(26)19-21-11-5-2-6-12-21/h2-18,20H,19H2,1H3.
What are the key properties of 2-benzyl-N-methoxy-N,4-diphenylbenzamide?
2-benzyl-N-methoxy-N,4-diphenylbenzamide has a molecular weight of 393.49 g/mol, XLogP of 6.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N-methoxy-N,4-diphenylbenzamide is sourced from PubChem (CID 87843433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).