About ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate
ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate (PubChem CID 87843630) has the molecular formula C5H12O7S
and a molecular weight of 216.21 g/mol. Its IUPAC name is ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate.
Molecular Properties
| Compound Name | ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate |
| PubChem CID | 87843630 |
| Molecular Formula | C5H12O7S |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate |
| SMILES | C=CCOS(=O)(=O)O.CC(O)(O)O |
| InChI | InChI=1S/C3H6O4S.C2H6O3/c1-2-3-7-8(4,5)6;1-2(3,4)5/h2H,1,3H2,(H,4,5,6);3-5H,1H3 |
| InChIKey | UDKGADCADRDZAO-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate?
The IUPAC name of ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate (CID 87843630) is ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate.
What is the SMILES notation for ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate?
The canonical SMILES for ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate is C=CCOS(=O)(=O)O.CC(O)(O)O.
What is the InChIKey of ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate?
The InChIKey is UDKGADCADRDZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4S.C2H6O3/c1-2-3-7-8(4,5)6;1-2(3,4)5/h2H,1,3H2,(H,4,5,6);3-5H,1H3.
What are the key properties of ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate?
ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate has a molecular weight of 216.21 g/mol, XLogP of -1.37, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1,1-triol;prop-2-enyl hydrogen sulfate is sourced from PubChem (CID 87843630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).