C13H15AsN2O6 — CID 87843797
ethyl 3-[(E)-2-dimethylarsanylethenyl]-2,6-dinitrobenzoate (PubChem CID 87843797) has the molecular formula C13H15AsN2O6 and a molecular weight of 370.19 g/mol. Its IUPAC name is ethyl 3-[(E)-2-dimethylarsanylethenyl]-2,6-dinitrobenzoate.
| Compound Name | ethyl 3-[(E)-2-dimethylarsanylethenyl]-2,6-dinitrobenzoate |
|---|---|
| PubChem CID | 87843797 |
| Molecular Formula | C13H15AsN2O6 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | ethyl 3-[(E)-2-dimethylarsanylethenyl]-2,6-dinitrobenzoate |
| SMILES | CCOC(=O)c1c([N+](=O)[O-])ccc(/C=C/[As](C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15AsN2O6/c1-4-22-13(17)11-10(15(18)19)6-5-9(7-8-14(2)3)12(11)16(20)21/h5-8H,4H2,1-3H3/b8-7+ |
| InChIKey | HFGPMWOFPOLGCM-BQYQJAHWSA-N |
| XLogP | 2.99 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|