About 1-chloro-N',N'-diethylpropane-1,3-diamine
1-chloro-N',N'-diethylpropane-1,3-diamine (PubChem CID 87843993) has the molecular formula C7H17ClN2
and a molecular weight of 164.68 g/mol. Its IUPAC name is 1-chloro-N',N'-diethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | 1-chloro-N',N'-diethylpropane-1,3-diamine |
| PubChem CID | 87843993 |
| Molecular Formula | C7H17ClN2 |
| Molecular Weight | 164.68 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-chloro-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)Cl |
| InChI | InChI=1S/C7H17ClN2/c1-3-10(4-2)6-5-7(8)9/h7H,3-6,9H2,1-2H3 |
| InChIKey | PTQWIVDJXKWBQL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.68 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-N',N'-diethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-N',N'-diethylpropane-1,3-diamine?
The IUPAC name of 1-chloro-N',N'-diethylpropane-1,3-diamine (CID 87843993) is 1-chloro-N',N'-diethylpropane-1,3-diamine.
What is the SMILES notation for 1-chloro-N',N'-diethylpropane-1,3-diamine?
The canonical SMILES for 1-chloro-N',N'-diethylpropane-1,3-diamine is CCN(CC)CCC(N)Cl.
What is the InChIKey of 1-chloro-N',N'-diethylpropane-1,3-diamine?
The InChIKey is PTQWIVDJXKWBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17ClN2/c1-3-10(4-2)6-5-7(8)9/h7H,3-6,9H2,1-2H3.
What are the key properties of 1-chloro-N',N'-diethylpropane-1,3-diamine?
1-chloro-N',N'-diethylpropane-1,3-diamine has a molecular weight of 164.68 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-N',N'-diethylpropane-1,3-diamine is sourced from PubChem (CID 87843993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).