C14H16N2O14S3 — CID 87844432
1-[3-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropyl]sulfanylpropanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 87844432) has the molecular formula C14H16N2O14S3 and a molecular weight of 532.48 g/mol. Its IUPAC name is 1-[3-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropyl]sulfanylpropanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[3-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropyl]sulfanylpropanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 87844432 |
| Molecular Formula | C14H16N2O14S3 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 531.98 |
| IUPAC Name | 1-[3-[3-(2,5-dioxo-3-sulfopyrrolidin-1-yl)oxy-3-oxopropyl]sulfanylpropanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCSCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C14H16N2O14S3/c17-9-5-7(32(23,24)25)13(21)15(9)29-11(19)1-3-31-4-2-12(20)30-16-10(18)6-8(14(16)22)33(26,27)28/h7-8H,1-6H2,(H,23,24,25)(H,26,27,28) |
| InChIKey | CMLPWRQREMXDEO-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 236.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|