C29H20O — CID 87844442
11-oxatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene;pyrene (PubChem CID 87844442) has the molecular formula C29H20O and a molecular weight of 384.48 g/mol. Its IUPAC name is 11-oxatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene;pyrene.
| Compound Name | 11-oxatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene;pyrene |
|---|---|
| PubChem CID | 87844442 |
| Molecular Formula | C29H20O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 11-oxatetracyclo[7.4.1.05,14.010,12]tetradeca-1,3,5(14),6,8-pentaene;pyrene |
| SMILES | c1cc2c3c(cccc3c1)C1OC1C2.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C13H10O/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-8-4-2-6-10-12(8)9(5-1)7-11-13(10)14-11/h1-10H;1-6,11,13H,7H2 |
| InChIKey | XVMOWYNMRNHYMY-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|