About bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+)
bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) (PubChem CID 87844513) has the molecular formula C18H16Cl2O2S2Zr
and a molecular weight of 490.59 g/mol. Its IUPAC name is bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+).
Molecular Properties
| Compound Name | bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) |
| PubChem CID | 87844513 |
| Molecular Formula | C18H16Cl2O2S2Zr |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 487.90 |
| IUPAC Name | bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) |
| SMILES | Oc1cc(Cl)cs1.Oc1cc(Cl)cs1.[C-]1=CC=CC1.[C-]1=CC=CC1.[Zr+2] |
| InChI | InChI=1S/2C5H5.2C4H3ClOS.Zr/c2*1-2-4-5-3-1;2*5-3-1-4(6)7-2-3;/h2*1-3H,4H2;2*1-2,6H;/q2*-1;;;+2 |
| InChIKey | ODJUNPDQDNTJHV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+)?
The IUPAC name of bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) (CID 87844513) is bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+).
What is the SMILES notation for bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+)?
The canonical SMILES for bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) is Oc1cc(Cl)cs1.Oc1cc(Cl)cs1.[C-]1=CC=CC1.[C-]1=CC=CC1.[Zr+2].
What is the InChIKey of bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+)?
The InChIKey is ODJUNPDQDNTJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5.2C4H3ClOS.Zr/c2*1-2-4-5-3-1;2*5-3-1-4(6)7-2-3;/h2*1-3H,4H2;2*1-2,6H;/q2*-1;;;+2.
What are the key properties of bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+)?
bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) has a molecular weight of 490.59 g/mol, XLogP of 6.82, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorothiophen-2-ol);bis(cyclopenta-1,3-diene);zirconium(2+) is sourced from PubChem (CID 87844513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).