C30H26ClNO6S — CID 87845077
2-[4-[(2S,3R)-3-[(3S)-3-(2-chlorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]benzenesulfonic acid (PubChem CID 87845077) has the molecular formula C30H26ClNO6S and a molecular weight of 564.06 g/mol. Its IUPAC name is 2-[4-[(2S,3R)-3-[(3S)-3-(2-chlorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]benzenesulfonic acid.
| Compound Name | 2-[4-[(2S,3R)-3-[(3S)-3-(2-chlorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87845077 |
| Molecular Formula | C30H26ClNO6S |
| Molecular Weight | 564.06 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 2-[4-[(2S,3R)-3-[(3S)-3-(2-chlorophenyl)-3-hydroxypropyl]-4-oxo-1-phenylazetidin-2-yl]-3-hydroxyphenyl]benzenesulfonic acid |
| SMILES | O=C1[C@H](CC[C@H](O)c2ccccc2Cl)[C@@H](c2ccc(-c3ccccc3S(=O)(=O)O)cc2O)N1c1ccccc1 |
| InChI | InChI=1S/C30H26ClNO6S/c31-25-12-6-4-11-22(25)26(33)17-16-24-29(32(30(24)35)20-8-2-1-3-9-20)23-15-14-19(18-27(23)34)21-10-5-7-13-28(21)39(36,37)38/h1-15,18,24,26,29,33-34H,16-17H2,(H,36,37,38)/t24-,26+,29-/m1/s1 |
| InChIKey | CBAXYGJNOYQRSN-DOBADDLBSA-N |
| XLogP | 6.18 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.06 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|