About 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid
2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid (PubChem CID 87846068) has the molecular formula C9H9FN2O2S
and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid |
| PubChem CID | 87846068 |
| Molecular Formula | C9H9FN2O2S |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid |
| SMILES | O=C(O)CC1(S)Nc2ccc(F)cc2N1 |
| InChI | InChI=1S/C9H9FN2O2S/c10-5-1-2-6-7(3-5)12-9(15,11-6)4-8(13)14/h1-3,11-12,15H,4H2,(H,13,14) |
| InChIKey | USWUZFKNWKTCTL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid?
The IUPAC name of 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid (CID 87846068) is 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid?
The canonical SMILES for 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid is O=C(O)CC1(S)Nc2ccc(F)cc2N1.
What is the InChIKey of 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid?
The InChIKey is USWUZFKNWKTCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O2S/c10-5-1-2-6-7(3-5)12-9(15,11-6)4-8(13)14/h1-3,11-12,15H,4H2,(H,13,14).
What are the key properties of 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid?
2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid has a molecular weight of 228.25 g/mol, XLogP of 1.72, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2-sulfanyl-1,3-dihydrobenzimidazol-2-yl)acetic acid is sourced from PubChem (CID 87846068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).