C26H5Br8F5N4 — CID 87847293
2,3,7,8,12,13,17,18-octabromo-15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin (PubChem CID 87847293) has the molecular formula C26H5Br8F5N4 and a molecular weight of 1107.58 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octabromo-15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octabromo-15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 87847293 |
| Molecular Formula | C26H5Br8F5N4 |
| Molecular Weight | 1107.58 g/mol |
| Exact Mass | 1099.39 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octabromo-15-(2,3,4,5,6-pentafluorophenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(cc4[nH]c(cc5[nH]c(cc6nc2C(Br)=C6Br)c(Br)c5Br)c(Br)c4Br)C(Br)=C3Br)c(F)c1F |
| InChI | InChI=1S/C26H5Br8F5N4/c27-12-4-1-5-13(28)15(30)7(41-5)3-9-17(32)19(34)26(43-9)11(10-20(35)22(37)24(39)23(38)21(10)36)25-18(33)16(31)8(42-25)2-6(40-4)14(12)29/h1-3,40-41H/b4-1-,5-1-,6-2-,7-3-,8-2-,9-3-,25-11-,26-11- |
| InChIKey | QSIPBSJRUHOFSG-YPHASUDISA-N |
| XLogP | 12.96 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.58 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|