About 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione
3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione (PubChem CID 87847811) has the molecular formula C20H23NO3
and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione |
| PubChem CID | 87847811 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCOc1c(C(C)=C2Nc3ccccc3C2(C)C)c(=O)c1=O |
| InChI | InChI=1S/C20H23NO3/c1-5-6-11-24-18-15(16(22)17(18)23)12(2)19-20(3,4)13-9-7-8-10-14(13)21-19/h7-10,21H,5-6,11H2,1-4H3 |
| InChIKey | RTJPDRIDCFLTGP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione?
The IUPAC name of 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione (CID 87847811) is 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione.
What is the SMILES notation for 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione?
The canonical SMILES for 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione is CCCCOc1c(C(C)=C2Nc3ccccc3C2(C)C)c(=O)c1=O.
What is the InChIKey of 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione?
The InChIKey is RTJPDRIDCFLTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO3/c1-5-6-11-24-18-15(16(22)17(18)23)12(2)19-20(3,4)13-9-7-8-10-14(13)21-19/h7-10,21H,5-6,11H2,1-4H3.
What are the key properties of 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione?
3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione has a molecular weight of 325.41 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-4-[1-(3,3-dimethyl-1H-indol-2-ylidene)ethyl]cyclobut-3-ene-1,2-dione is sourced from PubChem (CID 87847811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).