C5H4F5N3 — CID 87848138
5-(1,2,2,3,3-pentafluoropropyl)-1H-1,2,4-triazole (PubChem CID 87848138) has the molecular formula C5H4F5N3 and a molecular weight of 201.10 g/mol. Its IUPAC name is 5-(1,2,2,3,3-pentafluoropropyl)-1H-1,2,4-triazole.
| Compound Name | 5-(1,2,2,3,3-pentafluoropropyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 87848138 |
| Molecular Formula | C5H4F5N3 |
| Molecular Weight | 201.10 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 5-(1,2,2,3,3-pentafluoropropyl)-1H-1,2,4-triazole |
| SMILES | FC(F)C(F)(F)C(F)c1ncn[nH]1 |
| InChI | InChI=1S/C5H4F5N3/c6-2(3-11-1-12-13-3)5(9,10)4(7)8/h1-2,4H,(H,11,12,13) |
| InChIKey | XYGIUYSBVHKTAZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|