C40H44N5O8S+ — CID 87848321
[4-[[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-[(3S)-1-[(3,4-dimethoxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]carbamoyl]amino]phenyl] quinoline-8-sulfonate (PubChem CID 87848321) has the molecular formula C40H44N5O8S+ and a molecular weight of 754.89 g/mol. Its IUPAC name is [4-[[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-[(3S)-1-[(3,4-dimethoxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]carbamoyl]amino]phenyl] quinoline-8-sulfonate.
| Compound Name | [4-[[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-[(3S)-1-[(3,4-dimethoxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]carbamoyl]amino]phenyl] quinoline-8-sulfonate |
|---|---|
| PubChem CID | 87848321 |
| Molecular Formula | C40H44N5O8S+ |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.29 |
| IUPAC Name | [4-[[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]-[(3S)-1-[(3,4-dimethoxyphenyl)methyl]-1-methylpiperidin-1-ium-3-yl]carbamoyl]amino]phenyl] quinoline-8-sulfonate |
| SMILES | COc1ccc(C[N+]2(C)CCC[C@H](N(C(=O)Nc3ccc(OS(=O)(=O)c4cccc5cccnc45)cc3)C(=O)[C@@H](N)Cc3ccc(O)cc3)C2)cc1OC |
| InChI | InChI=1S/C40H43N5O8S/c1-45(25-28-13-20-35(51-2)36(24-28)52-3)22-6-9-31(26-45)44(39(47)34(41)23-27-11-16-32(46)17-12-27)40(48)43-30-14-18-33(19-15-30)53-54(49,50)37-10-4-7-29-8-5-21-42-38(29)37/h4-5,7-8,10-21,24,31,34H,6,9,22-23,25-26,41H2,1-3H3,(H-,43,46,48)/p+1/t31-,34-,45?/m0/s1 |
| InChIKey | OSQSWSSIZBDUHF-QTSDBFBHSA-O |
| XLogP | 5.47 |
| TPSA | 170.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|