C25H30N4O4S — CID 87848807
tert-butyl N-[[3-[[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 87848807) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is tert-butyl N-[[3-[[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 87848807 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | tert-butyl N-[[3-[[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(C(=O)NCC(SCc2ccccc2)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C25H30N4O4S/c1-25(2,3)33-24(32)29-15-19-10-7-11-20(14-19)22(30)28-16-21(23(31)27-13-12-26)34-17-18-8-5-4-6-9-18/h4-11,14,21H,13,15-17H2,1-3H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | BDDGUAHPWCMFMH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|