C29H42N2O7S2Si — CID 87849948
[4-(2-butylphenyl)-3-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-trimethylsilylethoxymethyl)sulfamoyl]phenyl]methyl methanesulfonate (PubChem CID 87849948) has the molecular formula C29H42N2O7S2Si and a molecular weight of 622.88 g/mol. Its IUPAC name is [4-(2-butylphenyl)-3-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-trimethylsilylethoxymethyl)sulfamoyl]phenyl]methyl methanesulfonate.
| Compound Name | [4-(2-butylphenyl)-3-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-trimethylsilylethoxymethyl)sulfamoyl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87849948 |
| Molecular Formula | C29H42N2O7S2Si |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [4-(2-butylphenyl)-3-[(3,4-dimethyl-1,2-oxazol-5-yl)-(1-trimethylsilylethoxymethyl)sulfamoyl]phenyl]methyl methanesulfonate |
| SMILES | CCCCc1ccccc1-c1ccc(COS(C)(=O)=O)cc1S(=O)(=O)N(COC(C)[Si](C)(C)C)c1onc(C)c1C |
| InChI | InChI=1S/C29H42N2O7S2Si/c1-9-10-13-25-14-11-12-15-26(25)27-17-16-24(19-37-39(5,32)33)18-28(27)40(34,35)31(20-36-23(4)41(6,7)8)29-21(2)22(3)30-38-29/h11-12,14-18,23H,9-10,13,19-20H2,1-8H3 |
| InChIKey | UNGKILAQNXOWLP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|