About buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane
buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane (PubChem CID 87850029) has the molecular formula C12H22OSi
and a molecular weight of 210.39 g/mol. Its IUPAC name is buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane.
Molecular Properties
| Compound Name | buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane |
| PubChem CID | 87850029 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane |
| SMILES | C=CC=C[Si](C)(C)CC1CCOCC1 |
| InChI | InChI=1S/C12H22OSi/c1-4-5-10-14(2,3)11-12-6-8-13-9-7-12/h4-5,10,12H,1,6-9,11H2,2-3H3 |
| InChIKey | PYQBRLYPBFQCRE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane?
The IUPAC name of buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane (CID 87850029) is buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane.
What is the SMILES notation for buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane?
The canonical SMILES for buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane is C=CC=C[Si](C)(C)CC1CCOCC1.
What is the InChIKey of buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane?
The InChIKey is PYQBRLYPBFQCRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22OSi/c1-4-5-10-14(2,3)11-12-6-8-13-9-7-12/h4-5,10,12H,1,6-9,11H2,2-3H3.
What are the key properties of buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane?
buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane has a molecular weight of 210.39 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-dienyl-dimethyl-(oxan-4-ylmethyl)silane is sourced from PubChem (CID 87850029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).