About CID 87850413
CID 87850413 (PubChem CID 87850413) has the molecular formula C17H26AsO2
and a molecular weight of 337.32 g/mol.
Molecular Properties
| Compound Name | CID 87850413 |
| PubChem CID | 87850413 |
| Molecular Formula | C17H26AsO2 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(OCC(O)C(C)[As]C(C)C)c2c1CCC2 |
| InChI | InChI=1S/C17H26AsO2/c1-11(2)18-13(4)16(19)10-20-17-9-8-12(3)14-6-5-7-15(14)17/h8-9,11,13,16,19H,5-7,10H2,1-4H3 |
| InChIKey | WMZFONFODHBMOZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87850413 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87850413?
The IUPAC name of CID 87850413 (CID 87850413) is not available.
What is the SMILES notation for CID 87850413?
The canonical SMILES for CID 87850413 is Cc1ccc(OCC(O)C(C)[As]C(C)C)c2c1CCC2.
What is the InChIKey of CID 87850413?
The InChIKey is WMZFONFODHBMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26AsO2/c1-11(2)18-13(4)16(19)10-20-17-9-8-12(3)14-6-5-7-15(14)17/h8-9,11,13,16,19H,5-7,10H2,1-4H3.
What are the key properties of CID 87850413?
CID 87850413 has a molecular weight of 337.32 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87850413 is sourced from PubChem (CID 87850413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).