C28H27F4N3O6 — CID 87850662
2-[2-[(4-fluorophenyl)methyl]-1,8-dioxo-9-phenylmethoxy-4,7-dihydro-3H-pyrido[1,2-a]pyrazin-5-ium-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetate (PubChem CID 87850662) has the molecular formula C28H27F4N3O6 and a molecular weight of 577.53 g/mol. Its IUPAC name is 2-[2-[(4-fluorophenyl)methyl]-1,8-dioxo-9-phenylmethoxy-4,7-dihydro-3H-pyrido[1,2-a]pyrazin-5-ium-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetate.
| Compound Name | 2-[2-[(4-fluorophenyl)methyl]-1,8-dioxo-9-phenylmethoxy-4,7-dihydro-3H-pyrido[1,2-a]pyrazin-5-ium-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87850662 |
| Molecular Formula | C28H27F4N3O6 |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 2-[2-[(4-fluorophenyl)methyl]-1,8-dioxo-9-phenylmethoxy-4,7-dihydro-3H-pyrido[1,2-a]pyrazin-5-ium-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetate |
| SMILES | CN(C)C(=O)CC1CN(Cc2ccc(F)cc2)C(=O)C2=C(OCc3ccccc3)C(=O)CC=[N+]21.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H27FN3O4.C2HF3O2/c1-28(2)23(32)14-21-16-29(15-18-8-10-20(27)11-9-18)26(33)24-25(22(31)12-13-30(21)24)34-17-19-6-4-3-5-7-19;3-2(4,5)1(6)7/h3-11,13,21H,12,14-17H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | ZLULSUMZVRQRIX-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|