C19H35F6NO12S2 — CID 87850882
[2-[[3-[2-(hydroxysulfamoyloxymethyl)-2-methyl-3-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,2-trifluoroethoxy)propyl] hydrogen sulfate (PubChem CID 87850882) has the molecular formula C19H35F6NO12S2 and a molecular weight of 647.61 g/mol. Its IUPAC name is [2-[[3-[2-(hydroxysulfamoyloxymethyl)-2-methyl-3-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,2-trifluoroethoxy)propyl] hydrogen sulfate.
| Compound Name | [2-[[3-[2-(hydroxysulfamoyloxymethyl)-2-methyl-3-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,2-trifluoroethoxy)propyl] hydrogen sulfate |
|---|---|
| PubChem CID | 87850882 |
| Molecular Formula | C19H35F6NO12S2 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | [2-[[3-[2-(hydroxysulfamoyloxymethyl)-2-methyl-3-(2,2,2-trifluoroethoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,2-trifluoroethoxy)propyl] hydrogen sulfate |
| SMILES | CC(C)(COCC(C)(COCC(F)(F)F)COS(=O)(=O)O)COCC(C)(COCC(F)(F)F)COS(=O)(=O)NO |
| InChI | InChI=1S/C19H35F6NO12S2/c1-15(2,6-34-8-17(4,12-38-40(30,31)32)10-36-14-19(23,24)25)5-33-7-16(3,9-35-13-18(20,21)22)11-37-39(28,29)26-27/h26-27H,5-14H2,1-4H3,(H,30,31,32) |
| InChIKey | VYLUBDHEMHCFKD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 176.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|