C22H26BrNO — CID 87851171
(NE)-N-[(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(4-methylphenyl)methylidene]hydroxylamine (PubChem CID 87851171) has the molecular formula C22H26BrNO and a molecular weight of 400.36 g/mol. Its IUPAC name is (NE)-N-[(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(4-methylphenyl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(4-methylphenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 87851171 |
| Molecular Formula | C22H26BrNO |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (NE)-N-[(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-(4-methylphenyl)methylidene]hydroxylamine |
| SMILES | Cc1ccc(/C(=N\O)c2cc3c(cc2Br)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C22H26BrNO/c1-14-6-8-15(9-7-14)20(24-25)16-12-17-18(13-19(16)23)22(4,5)11-10-21(17,2)3/h6-9,12-13,25H,10-11H2,1-5H3/b24-20+ |
| InChIKey | ATKWNSMUMUBKIE-HIXSDJFHSA-N |
| XLogP | 6.33 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|