C23H25NO — CID 87851298
1-(1-benzylindol-3-yl)-2,2,3,3-tetramethylcyclopropane-1-carbaldehyde (PubChem CID 87851298) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-(1-benzylindol-3-yl)-2,2,3,3-tetramethylcyclopropane-1-carbaldehyde.
| Compound Name | 1-(1-benzylindol-3-yl)-2,2,3,3-tetramethylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 87851298 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(1-benzylindol-3-yl)-2,2,3,3-tetramethylcyclopropane-1-carbaldehyde |
| SMILES | CC1(C)C(C)(C)C1(C=O)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H25NO/c1-21(2)22(3,4)23(21,16-25)19-15-24(14-17-10-6-5-7-11-17)20-13-9-8-12-18(19)20/h5-13,15-16H,14H2,1-4H3 |
| InChIKey | FXUBCXWCYKCCTN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|