About 12-(diethylamino)dodecyl formate
12-(diethylamino)dodecyl formate (PubChem CID 87851573) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is 12-(diethylamino)dodecyl formate.
Molecular Properties
| Compound Name | 12-(diethylamino)dodecyl formate |
| PubChem CID | 87851573 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 12-(diethylamino)dodecyl formate |
| SMILES | CCN(CC)CCCCCCCCCCCCOC=O |
| InChI | InChI=1S/C17H35NO2/c1-3-18(4-2)15-13-11-9-7-5-6-8-10-12-14-16-20-17-19/h17H,3-16H2,1-2H3 |
| InChIKey | SHNZYVHSUBHRSX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-(diethylamino)dodecyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(diethylamino)dodecyl formate?
The IUPAC name of 12-(diethylamino)dodecyl formate (CID 87851573) is 12-(diethylamino)dodecyl formate.
What is the SMILES notation for 12-(diethylamino)dodecyl formate?
The canonical SMILES for 12-(diethylamino)dodecyl formate is CCN(CC)CCCCCCCCCCCCOC=O.
What is the InChIKey of 12-(diethylamino)dodecyl formate?
The InChIKey is SHNZYVHSUBHRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-3-18(4-2)15-13-11-9-7-5-6-8-10-12-14-16-20-17-19/h17H,3-16H2,1-2H3.
What are the key properties of 12-(diethylamino)dodecyl formate?
12-(diethylamino)dodecyl formate has a molecular weight of 285.47 g/mol, XLogP of 4.40, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(diethylamino)dodecyl formate is sourced from PubChem (CID 87851573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).