C17H32N4O6 — CID 87851635
2-[4-(carboxymethyl)-7-(2-hydroxypropyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 87851635) has the molecular formula C17H32N4O6 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-7-(2-hydroxypropyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-(carboxymethyl)-7-(2-hydroxypropyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 87851635 |
| Molecular Formula | C17H32N4O6 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-[4-(carboxymethyl)-7-(2-hydroxypropyl)-10-(2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(O)CN1CCN(CC=O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H32N4O6/c1-15(23)12-19-4-2-18(10-11-22)3-5-20(13-16(24)25)8-9-21(7-6-19)14-17(26)27/h11,15,23H,2-10,12-14H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | AUULWKOOFCLXAG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|