C28H39F3N6O6S — CID 87852697
[1-[4-[2-[2-acetamido-5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-(carboxyamino)-2,2-dimethylpropyl]-tert-butylcarbamic acid (PubChem CID 87852697) has the molecular formula C28H39F3N6O6S and a molecular weight of 644.72 g/mol. Its IUPAC name is [1-[4-[2-[2-acetamido-5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-(carboxyamino)-2,2-dimethylpropyl]-tert-butylcarbamic acid.
| Compound Name | [1-[4-[2-[2-acetamido-5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-(carboxyamino)-2,2-dimethylpropyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87852697 |
| Molecular Formula | C28H39F3N6O6S |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | [1-[4-[2-[2-acetamido-5-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]-1,3-thiazol-4-yl]ethyl]anilino]-1-(carboxyamino)-2,2-dimethylpropyl]-tert-butylcarbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2ccc(NC(NC(=O)O)(N(C(=O)O)C(C)(C)C)C(C)(C)C)cc2)c(CN(C)C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C28H39F3N6O6S/c1-16(38)32-22-33-19(20(44-22)15-36(8)21(39)27(29,30)31)14-11-17-9-12-18(13-10-17)34-28(25(2,3)4,35-23(40)41)37(24(42)43)26(5,6)7/h9-10,12-13,34-35H,11,14-15H2,1-8H3,(H,40,41)(H,42,43)(H,32,33,38) |
| InChIKey | LKHAHXHJXDTORH-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 164.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|