About 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane
2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane (PubChem CID 87852873) has the molecular formula C15H34O2
and a molecular weight of 246.43 g/mol. Its IUPAC name is 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane.
Molecular Properties
| Compound Name | 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane |
| PubChem CID | 87852873 |
| Molecular Formula | C15H34O2 |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.26 |
| IUPAC Name | 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane |
| SMILES | CC(C)CCOCCC(C)C.CCC(C)(C)O |
| InChI | InChI=1S/C10H22O.C5H12O/c1-9(2)5-7-11-8-6-10(3)4;1-4-5(2,3)6/h9-10H,5-8H2,1-4H3;6H,4H2,1-3H3 |
| InChIKey | RYCZTPCAAMVWMQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane?
The IUPAC name of 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane (CID 87852873) is 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane.
What is the SMILES notation for 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane?
The canonical SMILES for 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane is CC(C)CCOCCC(C)C.CCC(C)(C)O.
What is the InChIKey of 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane?
The InChIKey is RYCZTPCAAMVWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.C5H12O/c1-9(2)5-7-11-8-6-10(3)4;1-4-5(2,3)6/h9-10H,5-8H2,1-4H3;6H,4H2,1-3H3.
What are the key properties of 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane?
2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane has a molecular weight of 246.43 g/mol, XLogP of 4.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-ol;3-methyl-1-(3-methylbutoxy)butane is sourced from PubChem (CID 87852873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).