C16H21NO2 — CID 87853698
2-acetyl-N-(4-propylphenyl)pent-4-enamide (PubChem CID 87853698) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-acetyl-N-(4-propylphenyl)pent-4-enamide.
| Compound Name | 2-acetyl-N-(4-propylphenyl)pent-4-enamide |
|---|---|
| PubChem CID | 87853698 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-acetyl-N-(4-propylphenyl)pent-4-enamide |
| SMILES | C=CCC(C(C)=O)C(=O)Nc1ccc(CCC)cc1 |
| InChI | InChI=1S/C16H21NO2/c1-4-6-13-8-10-14(11-9-13)17-16(19)15(7-5-2)12(3)18/h5,8-11,15H,2,4,6-7H2,1,3H3,(H,17,19) |
| InChIKey | ILNOQJZWKDTYTR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|