C13H6Cl2F3I3N2O4 — CID 87853775
2,4,6-triiodo-5-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzene-1,3-dicarbonyl chloride (PubChem CID 87853775) has the molecular formula C13H6Cl2F3I3N2O4 and a molecular weight of 762.81 g/mol. Its IUPAC name is 2,4,6-triiodo-5-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzene-1,3-dicarbonyl chloride.
| Compound Name | 2,4,6-triiodo-5-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 87853775 |
| Molecular Formula | C13H6Cl2F3I3N2O4 |
| Molecular Weight | 762.81 g/mol |
| Exact Mass | 761.68 |
| IUPAC Name | 2,4,6-triiodo-5-[methyl-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]amino]benzene-1,3-dicarbonyl chloride |
| SMILES | CN(C(=O)CNC(=O)C(F)(F)F)c1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I |
| InChI | InChI=1S/C13H6Cl2F3I3N2O4/c1-23(3(24)2-22-12(27)13(16,17)18)9-7(20)4(10(14)25)6(19)5(8(9)21)11(15)26/h2H2,1H3,(H,22,27) |
| InChIKey | KXBUCLDVFHJKEB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|