C13H17NO9S2 — CID 87854006
N-tert-butyl-1-(6,8-disulfo-2,3-dihydro-1,4-benzodioxin-5-yl)methanimine oxide (PubChem CID 87854006) has the molecular formula C13H17NO9S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is N-tert-butyl-1-(6,8-disulfo-2,3-dihydro-1,4-benzodioxin-5-yl)methanimine oxide.
| Compound Name | N-tert-butyl-1-(6,8-disulfo-2,3-dihydro-1,4-benzodioxin-5-yl)methanimine oxide |
|---|---|
| PubChem CID | 87854006 |
| Molecular Formula | C13H17NO9S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-tert-butyl-1-(6,8-disulfo-2,3-dihydro-1,4-benzodioxin-5-yl)methanimine oxide |
| SMILES | CC(C)(C)[N+]([O-])=Cc1c(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1OCCO2 |
| InChI | InChI=1S/C13H17NO9S2/c1-13(2,3)14(15)7-8-9(24(16,17)18)6-10(25(19,20)21)12-11(8)22-4-5-23-12/h6-7H,4-5H2,1-3H3,(H,16,17,18)(H,19,20,21) |
| InChIKey | CQWYPIDDTAKWKM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|