C25H18F3N3O4S — CID 87854199
(2,2,2-trifluoroacetyl) 3-[[4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbonyl]amino]propanoate (PubChem CID 87854199) has the molecular formula C25H18F3N3O4S and a molecular weight of 513.50 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[[4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbonyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[[4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 87854199 |
| Molecular Formula | C25H18F3N3O4S |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[[4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carbonyl]amino]propanoate |
| SMILES | O=C(CCNC(=O)c1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H18F3N3O4S/c26-25(27,28)24(34)35-22(32)10-11-30-23(33)20-12-18-19(13-29-14-21(18)36-20)31-17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-9,12-14,31H,10-11H2,(H,30,33) |
| InChIKey | WGDAWFDPRMEABH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|