C22H13F3N2O3S — CID 87854206
(2,2,2-trifluoroacetyl) 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate (PubChem CID 87854206) has the molecular formula C22H13F3N2O3S and a molecular weight of 442.42 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 87854206 |
| Molecular Formula | C22H13F3N2O3S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-(4-phenylanilino)thieno[2,3-c]pyridine-2-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1cc2c(Nc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C22H13F3N2O3S/c23-22(24,25)21(29)30-20(28)18-10-16-17(11-26-12-19(16)31-18)27-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12,27H |
| InChIKey | MRZQWXDFNOEZIV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|