C41H52F3N3O7 — CID 87854534
tert-butyl (3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[[1-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-3,4-dihydro-2H-quinolin-7-yl]methoxy]piperidine-1-carboxylate (PubChem CID 87854534) has the molecular formula C41H52F3N3O7 and a molecular weight of 755.87 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[[1-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-3,4-dihydro-2H-quinolin-7-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[[1-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-3,4-dihydro-2H-quinolin-7-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87854534 |
| Molecular Formula | C41H52F3N3O7 |
| Molecular Weight | 755.87 g/mol |
| Exact Mass | 755.38 |
| IUPAC Name | tert-butyl (3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[[1-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-3,4-dihydro-2H-quinolin-7-yl]methoxy]piperidine-1-carboxylate |
| SMILES | COc1ccccc1COCCCOc1ccc([C@H]2CCN(C(=O)OC(C)(C)C)C[C@@H]2OCc2ccc3c(c2)N(CCNC(=O)C(F)(F)F)CCC3)cc1 |
| InChI | InChI=1S/C41H52F3N3O7/c1-40(2,3)54-39(49)47-21-18-34(30-14-16-33(17-15-30)52-24-8-23-51-28-32-9-5-6-11-36(32)50-4)37(26-47)53-27-29-12-13-31-10-7-20-46(35(31)25-29)22-19-45-38(48)41(42,43)44/h5-6,9,11-17,25,34,37H,7-8,10,18-24,26-28H2,1-4H3,(H,45,48)/t34-,37+/m1/s1 |
| InChIKey | AGEVSXIJAQFXGM-BLPFIKBVSA-N |
| XLogP | 7.42 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.87 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|