C32H37N3O4 — CID 87854639
(2R)-N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxo-1-(4-phenylphenyl)ethyl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 87854639) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is (2R)-N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxo-1-(4-phenylphenyl)ethyl]-N'-hydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxo-1-(4-phenylphenyl)ethyl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 87854639 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (2R)-N-[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxo-1-(4-phenylphenyl)ethyl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)NC(C(=O)N(C)C1Cc2ccccc2C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H37N3O4/c1-21(2)17-27(20-29(36)34-39)31(37)33-30(24-15-13-23(14-16-24)22-9-5-4-6-10-22)32(38)35(3)28-18-25-11-7-8-12-26(25)19-28/h4-16,21,27-28,30,39H,17-20H2,1-3H3,(H,33,37)(H,34,36)/t27-,30?/m1/s1 |
| InChIKey | AAXNFKSDOXCARY-NHQUYOMTSA-N |
| XLogP | 4.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|