C12H24Cl6N4 — CID 87854799
N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 87854799) has the molecular formula C12H24Cl6N4 and a molecular weight of 437.07 g/mol. Its IUPAC name is N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 87854799 |
| Molecular Formula | C12H24Cl6N4 |
| Molecular Weight | 437.07 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N'-[2-(2-aminoethylamino)ethyl]ethane-1,2-diamine;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.NCCNCCNCCN |
| InChI | InChI=1S/C6H6Cl6.C6H18N4/c7-1-2(8)4(10)6(12)5(11)3(1)9;7-1-3-9-5-6-10-4-2-8/h1-6H;9-10H,1-8H2 |
| InChIKey | NPRHZAGEPHUPKX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.07 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|