C23H20F6IN3O2 — CID 87855022
8-[3,5-bis(trifluoromethyl)benzoyl]-1-[iodo(phenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 87855022) has the molecular formula C23H20F6IN3O2 and a molecular weight of 611.32 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)benzoyl]-1-[iodo(phenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[3,5-bis(trifluoromethyl)benzoyl]-1-[iodo(phenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 87855022 |
| Molecular Formula | C23H20F6IN3O2 |
| Molecular Weight | 611.32 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)benzoyl]-1-[iodo(phenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCC2(CC1)C(=O)NCN2C(I)c1ccccc1 |
| InChI | InChI=1S/C23H20F6IN3O2/c24-22(25,26)16-10-15(11-17(12-16)23(27,28)29)19(34)32-8-6-21(7-9-32)20(35)31-13-33(21)18(30)14-4-2-1-3-5-14/h1-5,10-12,18H,6-9,13H2,(H,31,35) |
| InChIKey | LJBQTGMANWXTIT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|